C21H44O4 — CID 87098622
octadecanoic acid;propane-1,1-diol (PubChem CID 87098622) has the molecular formula C21H44O4 and a molecular weight of 360.58 g/mol. Its IUPAC name is octadecanoic acid;propane-1,1-diol.
| Compound Name | octadecanoic acid;propane-1,1-diol |
|---|---|
| PubChem CID | 87098622 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | octadecanoic acid;propane-1,1-diol |
| SMILES | CCC(O)O.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3(4)5/h2-17H2,1H3,(H,19,20);3-5H,2H2,1H3 |
| InChIKey | CZFZPEKTQBGRGK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|