C23H34N2O5 — CID 12773638
7-[3-(3-hydroxy-4,4-dimethyl-5-phenylpentyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid (PubChem CID 12773638) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is 7-[3-(3-hydroxy-4,4-dimethyl-5-phenylpentyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid.
| Compound Name | 7-[3-(3-hydroxy-4,4-dimethyl-5-phenylpentyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 12773638 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 7-[3-(3-hydroxy-4,4-dimethyl-5-phenylpentyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
| SMILES | CC(C)(Cc1ccccc1)C(O)CCN1C(=O)NC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H34N2O5/c1-23(2,16-17-10-6-5-7-11-17)19(26)14-15-25-18(21(29)24-22(25)30)12-8-3-4-9-13-20(27)28/h5-7,10-11,18-19,26H,3-4,8-9,12-16H2,1-2H3,(H,27,28)(H,24,29,30) |
| InChIKey | MCQWKAAVJKHQRD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|