C13H22N2O5 — CID 12788630
7-[3-(3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid (PubChem CID 12788630) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is 7-[3-(3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid.
| Compound Name | 7-[3-(3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 12788630 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 7-[3-(3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)NC(=O)N1CCCO |
| InChI | InChI=1S/C13H22N2O5/c16-9-5-8-15-10(12(19)14-13(15)20)6-3-1-2-4-7-11(17)18/h10,16H,1-9H2,(H,17,18)(H,14,19,20) |
| InChIKey | NKYCZKRRSBNICR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|