C18H30N2O5S — CID 10452755
7-[3-(2-cyclohexylsulfinylethyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid (PubChem CID 10452755) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is 7-[3-(2-cyclohexylsulfinylethyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid.
| Compound Name | 7-[3-(2-cyclohexylsulfinylethyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 10452755 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 7-[3-(2-cyclohexylsulfinylethyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)NC(=O)N1CCS(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H30N2O5S/c21-16(22)11-7-2-1-6-10-15-17(23)19-18(24)20(15)12-13-26(25)14-8-4-3-5-9-14/h14-15H,1-13H2,(H,21,22)(H,19,23,24) |
| InChIKey | UMTYFYSJWLUABR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|