C14H22N2O5S — CID 157038077
5-[(2S,4R)-4-[acetyl(acetylcarbamoyl)amino]thiolan-2-yl]pentanoic acid (PubChem CID 157038077) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 5-[(2S,4R)-4-[acetyl(acetylcarbamoyl)amino]thiolan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,4R)-4-[acetyl(acetylcarbamoyl)amino]thiolan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 157038077 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-[(2S,4R)-4-[acetyl(acetylcarbamoyl)amino]thiolan-2-yl]pentanoic acid |
| SMILES | CC(=O)NC(=O)N(C(C)=O)[C@H]1CS[C@@H](CCCCC(=O)O)C1 |
| InChI | InChI=1S/C14H22N2O5S/c1-9(17)15-14(21)16(10(2)18)11-7-12(22-8-11)5-3-4-6-13(19)20/h11-12H,3-8H2,1-2H3,(H,19,20)(H,15,17,21)/t11-,12+/m1/s1 |
| InChIKey | PVYHFDJQAMVUDF-NEPJUHHUSA-N |
| XLogP | 1.61 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|