C20H34N2O5 — CID 10385247
7-[(4S)-3-[(3R)-3-cyclohexyl-3-hydroxybutyl]-2,5-dioxoimidazolidin-4-yl]heptanoic acid (PubChem CID 10385247) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is 7-[(4S)-3-[(3R)-3-cyclohexyl-3-hydroxybutyl]-2,5-dioxoimidazolidin-4-yl]heptanoic acid.
| Compound Name | 7-[(4S)-3-[(3R)-3-cyclohexyl-3-hydroxybutyl]-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 10385247 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 7-[(4S)-3-[(3R)-3-cyclohexyl-3-hydroxybutyl]-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
| SMILES | C[C@@](O)(CCN1C(=O)NC(=O)[C@@H]1CCCCCCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C20H34N2O5/c1-20(27,15-9-5-4-6-10-15)13-14-22-16(18(25)21-19(22)26)11-7-2-3-8-12-17(23)24/h15-16,27H,2-14H2,1H3,(H,23,24)(H,21,25,26)/t16-,20+/m0/s1 |
| InChIKey | GEBSYWVGUNXNJW-OXJNMPFZSA-N |
| XLogP | 3.05 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|