C18H30N2O5S — CID 70611816
3-[3-[3-[3-(3-hydroxycyclohexyl)propyl]-2,5-dioxoimidazolidin-4-yl]propylsulfanyl]propanoic acid (PubChem CID 70611816) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is 3-[3-[3-[3-(3-hydroxycyclohexyl)propyl]-2,5-dioxoimidazolidin-4-yl]propylsulfanyl]propanoic acid.
| Compound Name | 3-[3-[3-[3-(3-hydroxycyclohexyl)propyl]-2,5-dioxoimidazolidin-4-yl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 70611816 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 3-[3-[3-[3-(3-hydroxycyclohexyl)propyl]-2,5-dioxoimidazolidin-4-yl]propylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCCC1C(=O)NC(=O)N1CCCC1CCCC(O)C1 |
| InChI | InChI=1S/C18H30N2O5S/c21-14-6-1-4-13(12-14)5-2-9-20-15(17(24)19-18(20)25)7-3-10-26-11-8-16(22)23/h13-15,21H,1-12H2,(H,22,23)(H,19,24,25) |
| InChIKey | HYTLKFJAMPZZEV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|