C25H36N2O2S — CID 11350862
1,3-bis(5-hydroxy-4-methyl-4-phenylpentyl)thiourea (PubChem CID 11350862) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is 1,3-bis(5-hydroxy-4-methyl-4-phenylpentyl)thiourea.
| Compound Name | 1,3-bis(5-hydroxy-4-methyl-4-phenylpentyl)thiourea |
|---|---|
| PubChem CID | 11350862 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1,3-bis(5-hydroxy-4-methyl-4-phenylpentyl)thiourea |
| SMILES | CC(CO)(CCCNC(=S)NCCCC(C)(CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N2O2S/c1-24(19-28,21-11-5-3-6-12-21)15-9-17-26-23(30)27-18-10-16-25(2,20-29)22-13-7-4-8-14-22/h3-8,11-14,28-29H,9-10,15-20H2,1-2H3,(H2,26,27,30) |
| InChIKey | GHILPKWAIOCXHV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|