C23H30N2O3S — CID 87985673
2-[4-[(4-hydroxy-3-methyl-3-phenylbutyl)carbamothioylamino]-2-methylphenyl]butanoic acid (PubChem CID 87985673) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-[4-[(4-hydroxy-3-methyl-3-phenylbutyl)carbamothioylamino]-2-methylphenyl]butanoic acid.
| Compound Name | 2-[4-[(4-hydroxy-3-methyl-3-phenylbutyl)carbamothioylamino]-2-methylphenyl]butanoic acid |
|---|---|
| PubChem CID | 87985673 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[4-[(4-hydroxy-3-methyl-3-phenylbutyl)carbamothioylamino]-2-methylphenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(NC(=S)NCCC(C)(CO)c2ccccc2)cc1C |
| InChI | InChI=1S/C23H30N2O3S/c1-4-19(21(27)28)20-11-10-18(14-16(20)2)25-22(29)24-13-12-23(3,15-26)17-8-6-5-7-9-17/h5-11,14,19,26H,4,12-13,15H2,1-3H3,(H,27,28)(H2,24,25,29) |
| InChIKey | XQHHRJCTPZAWIZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|