C25H34N2O4S — CID 87985484
5-[(5-hydroperoxy-3-methyl-3-phenylpentyl)carbamothioylamino]-3-methyl-3-phenylpentanoic acid (PubChem CID 87985484) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is 5-[(5-hydroperoxy-3-methyl-3-phenylpentyl)carbamothioylamino]-3-methyl-3-phenylpentanoic acid.
| Compound Name | 5-[(5-hydroperoxy-3-methyl-3-phenylpentyl)carbamothioylamino]-3-methyl-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 87985484 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 5-[(5-hydroperoxy-3-methyl-3-phenylpentyl)carbamothioylamino]-3-methyl-3-phenylpentanoic acid |
| SMILES | CC(CCNC(=S)NCCC(C)(CC(=O)O)c1ccccc1)(CCOO)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O4S/c1-24(15-18-31-30,20-9-5-3-6-10-20)13-16-26-23(32)27-17-14-25(2,19-22(28)29)21-11-7-4-8-12-21/h3-12,30H,13-19H2,1-2H3,(H,28,29)(H2,26,27,32) |
| InChIKey | GOQSCXUXBKGPHV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|