C37H42N4S7 — CID 91489113
1,3-bis[4-phenyl-4-(4-sulfanyl-6-sulfanylidene-2,3-dihydrothieno[3,2-c]pyridin-5-yl)pentyl]thiourea (PubChem CID 91489113) has the molecular formula C37H42N4S7 and a molecular weight of 767.24 g/mol. Its IUPAC name is 1,3-bis[4-phenyl-4-(4-sulfanyl-6-sulfanylidene-2,3-dihydrothieno[3,2-c]pyridin-5-yl)pentyl]thiourea.
| Compound Name | 1,3-bis[4-phenyl-4-(4-sulfanyl-6-sulfanylidene-2,3-dihydrothieno[3,2-c]pyridin-5-yl)pentyl]thiourea |
|---|---|
| PubChem CID | 91489113 |
| Molecular Formula | C37H42N4S7 |
| Molecular Weight | 767.24 g/mol |
| Exact Mass | 766.15 |
| IUPAC Name | 1,3-bis[4-phenyl-4-(4-sulfanyl-6-sulfanylidene-2,3-dihydrothieno[3,2-c]pyridin-5-yl)pentyl]thiourea |
| SMILES | CC(CCCNC(=S)NCCCC(C)(c1ccccc1)n1c(S)c2c(cc1=S)SCC2)(c1ccccc1)n1c(S)c2c(cc1=S)SCC2 |
| InChI | InChI=1S/C37H42N4S7/c1-36(25-11-5-3-6-12-25,40-31(42)23-29-27(33(40)44)15-21-47-29)17-9-19-38-35(46)39-20-10-18-37(2,26-13-7-4-8-14-26)41-32(43)24-30-28(34(41)45)16-22-48-30/h3-8,11-14,23-24,44-45H,9-10,15-22H2,1-2H3,(H2,38,39,46) |
| InChIKey | GIZVZQISRPWIKH-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 33.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.24 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|