C18H30N4S2 — CID 51881947
1-(3-methylsulfanylpropyl)-3-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]thiourea (PubChem CID 51881947) has the molecular formula C18H30N4S2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 51881947 |
| Molecular Formula | C18H30N4S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]thiourea |
| SMILES | CSCCCNC(=S)NC[C@@H](C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H30N4S2/c1-16(15-20-18(23)19-9-6-14-24-2)21-10-12-22(13-11-21)17-7-4-3-5-8-17/h3-5,7-8,16H,6,9-15H2,1-2H3,(H2,19,20,23)/t16-/m1/s1 |
| InChIKey | IIMMIONHPADUMN-MRXNPFEDSA-N |
| XLogP | 2.41 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|