C35H38N4O4S3 — CID 11787242
1,3-bis[3-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3-phenylbutyl]thiourea (PubChem CID 11787242) has the molecular formula C35H38N4O4S3 and a molecular weight of 674.91 g/mol. Its IUPAC name is 1,3-bis[3-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3-phenylbutyl]thiourea.
| Compound Name | 1,3-bis[3-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3-phenylbutyl]thiourea |
|---|---|
| PubChem CID | 11787242 |
| Molecular Formula | C35H38N4O4S3 |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | 1,3-bis[3-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3-phenylbutyl]thiourea |
| SMILES | CC(CCNC(=S)NCCC(C)(c1ccccc1)N1C(=O)C=C2SCCC2C1=O)(c1ccccc1)N1C(=O)C=C2SCCC2C1=O |
| InChI | InChI=1S/C35H38N4O4S3/c1-34(23-9-5-3-6-10-23,38-29(40)21-27-25(31(38)42)13-19-45-27)15-17-36-33(44)37-18-16-35(2,24-11-7-4-8-12-24)39-30(41)22-28-26(32(39)43)14-20-46-28/h3-12,21-22,25-26H,13-20H2,1-2H3,(H2,36,37,44) |
| InChIKey | RDRCEQZGHLUMKY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|