C28H40N2O6S2 — CID 21303490
5-[4-[2-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione (PubChem CID 21303490) has the molecular formula C28H40N2O6S2 and a molecular weight of 564.77 g/mol. Its IUPAC name is 5-[4-[2-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione.
| Compound Name | 5-[4-[2-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 21303490 |
| Molecular Formula | C28H40N2O6S2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 5-[4-[2-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
| SMILES | CC(C)(CCOCCOCCC(C)(C)CN1C(=O)C=C2SCCC2C1=O)CN1C(=O)C=C2SCCC2C1=O |
| InChI | InChI=1S/C28H40N2O6S2/c1-27(2,17-29-23(31)15-21-19(25(29)33)5-13-37-21)7-9-35-11-12-36-10-8-28(3,4)18-30-24(32)16-22-20(26(30)34)6-14-38-22/h15-16,19-20H,5-14,17-18H2,1-4H3 |
| InChIKey | GQCSTJVEFSNLMJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|