C32H44N2O4S4 — CID 87978360
5-[14-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3,12,12-tetramethyl-6,9-bis(sulfanylidene)tetradecyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione (PubChem CID 87978360) has the molecular formula C32H44N2O4S4 and a molecular weight of 648.98 g/mol. Its IUPAC name is 5-[14-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3,12,12-tetramethyl-6,9-bis(sulfanylidene)tetradecyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione.
| Compound Name | 5-[14-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3,12,12-tetramethyl-6,9-bis(sulfanylidene)tetradecyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 87978360 |
| Molecular Formula | C32H44N2O4S4 |
| Molecular Weight | 648.98 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 5-[14-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-3,3,12,12-tetramethyl-6,9-bis(sulfanylidene)tetradecyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
| SMILES | CC(C)(CCC(=S)CCC(=S)CCC(C)(C)CCN1C(=O)C=C2SCCC2C1=O)CCN1C(=O)C=C2SCCC2C1=O |
| InChI | InChI=1S/C32H44N2O4S4/c1-31(2,13-15-33-27(35)19-25-23(29(33)37)9-17-41-25)11-7-21(39)5-6-22(40)8-12-32(3,4)14-16-34-28(36)20-26-24(30(34)38)10-18-42-26/h19-20,23-24H,5-18H2,1-4H3 |
| InChIKey | GJVUPCMFYZIQAE-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.98 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|