C39H52N2O4S3 — CID 143080032
(Z)-N-[6-[5-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-4-methyl-6-sulfanylhex-2-enamide;formaldehyde (PubChem CID 143080032) has the molecular formula C39H52N2O4S3 and a molecular weight of 709.06 g/mol. Its IUPAC name is (Z)-N-[6-[5-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-4-methyl-6-sulfanylhex-2-enamide;formaldehyde.
| Compound Name | (Z)-N-[6-[5-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-4-methyl-6-sulfanylhex-2-enamide;formaldehyde |
|---|---|
| PubChem CID | 143080032 |
| Molecular Formula | C39H52N2O4S3 |
| Molecular Weight | 709.06 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | (Z)-N-[6-[5-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-4-methyl-6-sulfanylhex-2-enamide;formaldehyde |
| SMILES | C=O.CC(/C=C\C(=O)NC(C)(CCCCSCCCCC(C)(c1ccccc1)N1C(=O)C=C2SCCC2C1=O)c1ccccc1)CCS |
| InChI | InChI=1S/C38H50N2O3S3.CH2O/c1-29(20-24-44)18-19-34(41)39-37(2,30-14-6-4-7-15-30)22-10-12-25-45-26-13-11-23-38(3,31-16-8-5-9-17-31)40-35(42)28-33-32(36(40)43)21-27-46-33;1-2/h4-9,14-19,28-29,32,44H,10-13,20-27H2,1-3H3,(H,39,41);1H2/b19-18-; |
| InChIKey | LXSNPFNHNJZUEI-TVWXOORISA-N |
| XLogP | 8.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.06 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|