C38H44N2S7 — CID 22743173
5-[6-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 22743173) has the molecular formula C38H44N2S7 and a molecular weight of 753.25 g/mol. Its IUPAC name is 5-[6-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-[6-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 22743173 |
| Molecular Formula | C38H44N2S7 |
| Molecular Weight | 753.25 g/mol |
| Exact Mass | 752.15 |
| IUPAC Name | 5-[6-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5-phenylhexyl]sulfanyl-2-phenylhexan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CC(CCCCSCCCCC(C)(c1ccccc1)N1C(=S)C=C2SCCC2C1=S)(c1ccccc1)N1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C38H44N2S7/c1-37(27-13-5-3-6-14-27,39-33(41)25-31-29(35(39)43)17-23-46-31)19-9-11-21-45-22-12-10-20-38(2,28-15-7-4-8-16-28)40-34(42)26-32-30(36(40)44)18-24-47-32/h3-8,13-16,25-26,29-30H,9-12,17-24H2,1-2H3 |
| InChIKey | XFXCYEAULOQQCL-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.25 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|