C35H51NS4 — CID 143079948
(2E)-N-[6-(6-cyclohepta-1,3-dien-1-yl-5,5-dimethylhexyl)sulfanyl-2-phenylhexan-2-yl]-N-methyl-2-(2-sulfanylideneethylidene)thiolane-3-carbothioamide (PubChem CID 143079948) has the molecular formula C35H51NS4 and a molecular weight of 614.07 g/mol. Its IUPAC name is (2E)-N-[6-(6-cyclohepta-1,3-dien-1-yl-5,5-dimethylhexyl)sulfanyl-2-phenylhexan-2-yl]-N-methyl-2-(2-sulfanylideneethylidene)thiolane-3-carbothioamide.
| Compound Name | (2E)-N-[6-(6-cyclohepta-1,3-dien-1-yl-5,5-dimethylhexyl)sulfanyl-2-phenylhexan-2-yl]-N-methyl-2-(2-sulfanylideneethylidene)thiolane-3-carbothioamide |
|---|---|
| PubChem CID | 143079948 |
| Molecular Formula | C35H51NS4 |
| Molecular Weight | 614.07 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | (2E)-N-[6-(6-cyclohepta-1,3-dien-1-yl-5,5-dimethylhexyl)sulfanyl-2-phenylhexan-2-yl]-N-methyl-2-(2-sulfanylideneethylidene)thiolane-3-carbothioamide |
| SMILES | CN(C(=S)C1CCS/C1=C/C=S)C(C)(CCCCSCCCCC(C)(C)CC1=CC=CCCC1)c1ccccc1 |
| InChI | InChI=1S/C35H51NS4/c1-34(2,28-29-16-8-5-6-9-17-29)22-12-14-25-39-26-15-13-23-35(3,30-18-10-7-11-19-30)36(4)33(38)31-21-27-40-32(31)20-24-37/h5,7-8,10-11,16,18-20,24,31H,6,9,12-15,17,21-23,25-28H2,1-4H3/b32-20+ |
| InChIKey | SKAMSJOOJFXBLV-UZWMFBFFSA-N |
| XLogP | 10.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.07 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|