4-(carboxyamino)-3,3-dimethylbutanoic acid

C7H13NO4 — CID 122599753

IUPAC4-(carboxyamino)-3,3-dimethylbutanoic acid
SMILESCC(C)(CNC(=O)O)CC(=O)O
InChIInChI=1S/C7H13NO4/c1-7(2,3-5(9)10)4-8-6(11)12/h8H,3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyJRZVUMDURFEZGQ-UHFFFAOYSA-N
MW175.18 g/mol
LogP0.75
Rot. Bonds4

About 4-(carboxyamino)-3,3-dimethylbutanoic acid

4-(carboxyamino)-3,3-dimethylbutanoic acid (PubChem CID 122599753) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 4-(carboxyamino)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name4-(carboxyamino)-3,3-dimethylbutanoic acid
PubChem CID122599753
Molecular FormulaC7H13NO4
Molecular Weight175.18 g/mol
Exact Mass175.08
IUPAC Name4-(carboxyamino)-3,3-dimethylbutanoic acid
SMILESCC(C)(CNC(=O)O)CC(=O)O
InChIInChI=1S/C7H13NO4/c1-7(2,3-5(9)10)4-8-6(11)12/h8H,3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyJRZVUMDURFEZGQ-UHFFFAOYSA-N
XLogP0.75
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 50.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 4-(carboxyamino)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(carboxyamino)-3,3-dimethylbutanoic acid?
The IUPAC name of 4-(carboxyamino)-3,3-dimethylbutanoic acid (CID 122599753) is 4-(carboxyamino)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 4-(carboxyamino)-3,3-dimethylbutanoic acid?
The canonical SMILES for 4-(carboxyamino)-3,3-dimethylbutanoic acid is CC(C)(CNC(=O)O)CC(=O)O.
What is the InChIKey of 4-(carboxyamino)-3,3-dimethylbutanoic acid?
The InChIKey is JRZVUMDURFEZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-7(2,3-5(9)10)4-8-6(11)12/h8H,3-4H2,1-2H3,(H,9,10)(H,11,12).
What are the key properties of 4-(carboxyamino)-3,3-dimethylbutanoic acid?
4-(carboxyamino)-3,3-dimethylbutanoic acid has a molecular weight of 175.18 g/mol, XLogP of 0.75, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(carboxyamino)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 122599753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).