C18H38NO4+ — CID 177312184
[2-(carboxymethyl)-2,5-dihydroxytridecyl]-trimethylazanium (PubChem CID 177312184) has the molecular formula C18H38NO4+ and a molecular weight of 332.51 g/mol. Its IUPAC name is [2-(carboxymethyl)-2,5-dihydroxytridecyl]-trimethylazanium.
| Compound Name | [2-(carboxymethyl)-2,5-dihydroxytridecyl]-trimethylazanium |
|---|---|
| PubChem CID | 177312184 |
| Molecular Formula | C18H38NO4+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | [2-(carboxymethyl)-2,5-dihydroxytridecyl]-trimethylazanium |
| SMILES | CCCCCCCCC(O)CCC(O)(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C18H37NO4/c1-5-6-7-8-9-10-11-16(20)12-13-18(23,14-17(21)22)15-19(2,3)4/h16,20,23H,5-15H2,1-4H3/p+1 |
| InChIKey | USIFEHKJCBZFLL-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|