(10S)-10-hydroxyoctadecanoic acid

C18H36O3 — CID 91864452

IUPAC(10S)-10-hydroxyoctadecanoic acid
SMILESCCCCCCCC[C@H](O)CCCCCCCCC(=O)O
InChIInChI=1S/C18H36O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/t17-/m0/s1
InChIKeyPAZZVPKITDJCPV-KRWDZBQOSA-N
MW300.48 g/mol
LogP5.30
Rot. Bonds16

About (10S)-10-hydroxyoctadecanoic acid

(10S)-10-hydroxyoctadecanoic acid (PubChem CID 91864452) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is (10S)-10-hydroxyoctadecanoic acid.

Molecular Properties

Compound Name(10S)-10-hydroxyoctadecanoic acid
PubChem CID91864452
Molecular FormulaC18H36O3
Molecular Weight300.48 g/mol
Exact Mass300.27
IUPAC Name(10S)-10-hydroxyoctadecanoic acid
SMILESCCCCCCCC[C@H](O)CCCCCCCCC(=O)O
InChIInChI=1S/C18H36O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/t17-/m0/s1
InChIKeyPAZZVPKITDJCPV-KRWDZBQOSA-N
XLogP5.30
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds16
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500300.48
LogP ≤ 55.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (10S)-10-hydroxyoctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

21-hydroxyheptacosanoic acid
CID 169277079
(9R)-9-hydroxytetradecanoic acid
CID 22822871
14-hydroxypentacosanoic acid
CID 169276940
12-hydroxyheptadecanoic acid
CID 15110021
9-hydroxytriacontanoic acid
CID 169277258
hexadecan-7-ol;octadecanoic acid
CID 174589795
9-hydroxyheptadecanoic acid
CID 86012010
11-hydroxydocosanoic acid
CID 86066603
(8S)-8-hydroxytetradecanoic acid
CID 123133458
(7S)-7-hydroxyoctadecanoic acid
CID 162672751
12-hydroxyheptacosanoic acid
CID 169276954
20-hydroxyoctacosanoic acid
CID 169277392

Frequently Asked Questions

What is the IUPAC name of (10S)-10-hydroxyoctadecanoic acid?
The IUPAC name of (10S)-10-hydroxyoctadecanoic acid (CID 91864452) is (10S)-10-hydroxyoctadecanoic acid.
What is the SMILES notation for (10S)-10-hydroxyoctadecanoic acid?
The canonical SMILES for (10S)-10-hydroxyoctadecanoic acid is CCCCCCCC[C@H](O)CCCCCCCCC(=O)O.
What is the InChIKey of (10S)-10-hydroxyoctadecanoic acid?
The InChIKey is PAZZVPKITDJCPV-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H36O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/t17-/m0/s1.
What are the key properties of (10S)-10-hydroxyoctadecanoic acid?
(10S)-10-hydroxyoctadecanoic acid has a molecular weight of 300.48 g/mol, XLogP of 5.30, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10S)-10-hydroxyoctadecanoic acid is sourced from PubChem (CID 91864452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).