C20H39NO4 — CID 21401698
8-carbamoyl-12-hydroxy-16,16-dimethylheptadecanoic acid (PubChem CID 21401698) has the molecular formula C20H39NO4 and a molecular weight of 357.54 g/mol. Its IUPAC name is 8-carbamoyl-12-hydroxy-16,16-dimethylheptadecanoic acid.
| Compound Name | 8-carbamoyl-12-hydroxy-16,16-dimethylheptadecanoic acid |
|---|---|
| PubChem CID | 21401698 |
| Molecular Formula | C20H39NO4 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | 8-carbamoyl-12-hydroxy-16,16-dimethylheptadecanoic acid |
| SMILES | CC(C)(C)CCCC(O)CCCC(CCCCCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C20H39NO4/c1-20(2,3)15-9-13-17(22)12-8-11-16(19(21)25)10-6-4-5-7-14-18(23)24/h16-17,22H,4-15H2,1-3H3,(H2,21,25)(H,23,24) |
| InChIKey | HSMTUKKAYXNTDU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|