C19H38N2O4 — CID 54091292
7-[carbamoyl-(4-hydroxy-8,8-dimethylnonyl)amino]heptanoic acid (PubChem CID 54091292) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is 7-[carbamoyl-(4-hydroxy-8,8-dimethylnonyl)amino]heptanoic acid.
| Compound Name | 7-[carbamoyl-(4-hydroxy-8,8-dimethylnonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 54091292 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 7-[carbamoyl-(4-hydroxy-8,8-dimethylnonyl)amino]heptanoic acid |
| SMILES | CC(C)(C)CCCC(O)CCCN(CCCCCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C19H38N2O4/c1-19(2,3)13-8-10-16(22)11-9-15-21(18(20)25)14-7-5-4-6-12-17(23)24/h16,22H,4-15H2,1-3H3,(H2,20,25)(H,23,24) |
| InChIKey | MUASMCHCWBCNFY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|