C11H17BrO2 — CID 65150580
1-(5-bromofuran-2-yl)-4,4-dimethylpentan-1-ol (PubChem CID 65150580) has the molecular formula C11H17BrO2 and a molecular weight of 261.16 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(5-bromofuran-2-yl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 65150580 |
| Molecular Formula | C11H17BrO2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CCC(O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H17BrO2/c1-11(2,3)7-6-8(13)9-4-5-10(12)14-9/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | URTLJEZXBDWXPF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |