C11H14Br2O2 — CID 107978543
1-(3,5-dibromophenyl)-2-propan-2-yloxyethanol (PubChem CID 107978543) has the molecular formula C11H14Br2O2 and a molecular weight of 338.04 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-2-propan-2-yloxyethanol.
| Compound Name | 1-(3,5-dibromophenyl)-2-propan-2-yloxyethanol |
|---|---|
| PubChem CID | 107978543 |
| Molecular Formula | C11H14Br2O2 |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 1-(3,5-dibromophenyl)-2-propan-2-yloxyethanol |
| SMILES | CC(C)OCC(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H14Br2O2/c1-7(2)15-6-11(14)8-3-9(12)5-10(13)4-8/h3-5,7,11,14H,6H2,1-2H3 |
| InChIKey | BFCFPXSKIXUNFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |