C12H16Br2O — CID 107978546
1-(3,5-dibromophenyl)-2-ethylbutan-1-ol (PubChem CID 107978546) has the molecular formula C12H16Br2O and a molecular weight of 336.07 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-2-ethylbutan-1-ol.
| Compound Name | 1-(3,5-dibromophenyl)-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 107978546 |
| Molecular Formula | C12H16Br2O |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 1-(3,5-dibromophenyl)-2-ethylbutan-1-ol |
| SMILES | CCC(CC)C(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H16Br2O/c1-3-8(4-2)12(15)9-5-10(13)7-11(14)6-9/h5-8,12,15H,3-4H2,1-2H3 |
| InChIKey | SPPJEZFEYQPPME-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |