C15H25NO2 — CID 151143886
2-[4-amino-3,5-di(propan-2-yl)phenyl]propane-1,3-diol (PubChem CID 151143886) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[4-amino-3,5-di(propan-2-yl)phenyl]propane-1,3-diol.
| Compound Name | 2-[4-amino-3,5-di(propan-2-yl)phenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 151143886 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-[4-amino-3,5-di(propan-2-yl)phenyl]propane-1,3-diol |
| SMILES | CC(C)c1cc(C(CO)CO)cc(C(C)C)c1N |
| InChI | InChI=1S/C15H25NO2/c1-9(2)13-5-11(12(7-17)8-18)6-14(10(3)4)15(13)16/h5-6,9-10,12,17-18H,7-8,16H2,1-4H3 |
| InChIKey | MWTYVASFPZBNRE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|