C16H22N2 — CID 138683559
2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline (PubChem CID 138683559) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline.
| Compound Name | 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline |
|---|---|
| PubChem CID | 138683559 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline |
| SMILES | CC(C)c1cc(-n2cccc2)cc(C(C)C)c1N |
| InChI | InChI=1S/C16H22N2/c1-11(2)14-9-13(18-7-5-6-8-18)10-15(12(3)4)16(14)17/h5-12H,17H2,1-4H3 |
| InChIKey | FYPHYCTZJPQGRE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|