C24H28N2 — CID 160663340
2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine (PubChem CID 160663340) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine.
| Compound Name | 2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 160663340 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine |
| SMILES | [H]/N=C(/Cc1c(C(C)C)cc(-n2cccc2)cc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2/c1-17(2)21-14-20(26-12-8-9-13-26)15-22(18(3)4)23(21)16-24(25)19-10-6-5-7-11-19/h5-15,17-18,25H,16H2,1-4H3/b25-24- |
| InChIKey | JHGNLLXMYGKKGR-IZHYLOQSSA-N |
| XLogP | 6.33 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|