C16H28N2Si2 — CID 10573468
1-phenyl-4-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)butan-1-imine (PubChem CID 10573468) has the molecular formula C16H28N2Si2 and a molecular weight of 304.59 g/mol. Its IUPAC name is 1-phenyl-4-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)butan-1-imine.
| Compound Name | 1-phenyl-4-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)butan-1-imine |
|---|---|
| PubChem CID | 10573468 |
| Molecular Formula | C16H28N2Si2 |
| Molecular Weight | 304.59 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-phenyl-4-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)butan-1-imine |
| SMILES | [H]/N=C(\CCCN1[Si](C)(C)CC[Si]1(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H28N2Si2/c1-19(2)13-14-20(3,4)18(19)12-8-11-16(17)15-9-6-5-7-10-15/h5-7,9-10,17H,8,11-14H2,1-4H3/b17-16+ |
| InChIKey | LBZFIVSRYDCGIG-WUKNDPDISA-N |
| XLogP | 4.56 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|