C12H16N2O2S — CID 174435994
(2S)-2-amino-4-(2-imino-2-phenylethyl)sulfanylbutanoic acid (PubChem CID 174435994) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is (2S)-2-amino-4-(2-imino-2-phenylethyl)sulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-4-(2-imino-2-phenylethyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 174435994 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2S)-2-amino-4-(2-imino-2-phenylethyl)sulfanylbutanoic acid |
| SMILES | [H]/N=C(\CSCC[C@H](N)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O2S/c13-10(12(15)16)6-7-17-8-11(14)9-4-2-1-3-5-9/h1-5,10,14H,6-8,13H2,(H,15,16)/b14-11+/t10-/m0/s1 |
| InChIKey | JAJCVOTTZWYHFK-AYDSOBSRSA-N |
| XLogP | 1.59 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|