C13H17NO5S — CID 68512994
(2R)-2-amino-4-[[carboxy(phenyl)methoxy]methylsulfanyl]butanoic acid (PubChem CID 68512994) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2R)-2-amino-4-[[carboxy(phenyl)methoxy]methylsulfanyl]butanoic acid.
| Compound Name | (2R)-2-amino-4-[[carboxy(phenyl)methoxy]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 68512994 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2R)-2-amino-4-[[carboxy(phenyl)methoxy]methylsulfanyl]butanoic acid |
| SMILES | N[C@H](CCSCOC(C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17NO5S/c14-10(12(15)16)6-7-20-8-19-11(13(17)18)9-4-2-1-3-5-9/h1-5,10-11H,6-8,14H2,(H,15,16)(H,17,18)/t10-,11?/m1/s1 |
| InChIKey | DBXXACZYNPFDAS-NFJWQWPMSA-N |
| XLogP | 1.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|