C40H50N4 — CID 160809863
2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline;2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine (PubChem CID 160809863) has the molecular formula C40H50N4 and a molecular weight of 586.87 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline;2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine.
| Compound Name | 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline;2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 160809863 |
| Molecular Formula | C40H50N4 |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.40 |
| IUPAC Name | 2,6-di(propan-2-yl)-4-pyrrol-1-ylaniline;2-[2,6-di(propan-2-yl)-4-pyrrol-1-ylphenyl]-1-phenylethanimine |
| SMILES | CC(C)c1cc(-n2cccc2)cc(C(C)C)c1N.[H]/N=C(/Cc1c(C(C)C)cc(-n2cccc2)cc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2.C16H22N2/c1-17(2)21-14-20(26-12-8-9-13-26)15-22(18(3)4)23(21)16-24(25)19-10-6-5-7-11-19;1-11(2)14-9-13(18-7-5-6-8-18)10-15(12(3)4)16(14)17/h5-15,17-18,25H,16H2,1-4H3;5-12H,17H2,1-4H3/b25-24-; |
| InChIKey | SEEFEYZLRXZRBM-BJFQDICYSA-N |
| XLogP | 10.64 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|