C32H42N2O — CID 135997115
2-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenyl]iminomethyl]phenol (PubChem CID 135997115) has the molecular formula C32H42N2O and a molecular weight of 470.70 g/mol. Its IUPAC name is 2-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135997115 |
| Molecular Formula | C32H42N2O |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 2-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenyl]iminomethyl]phenol |
| SMILES | CC(C)c1cc(Cc2cc(C(C)C)c(/N=C/c3ccccc3O)c(C(C)C)c2)cc(C(C)C)c1N |
| InChI | InChI=1S/C32H42N2O/c1-19(2)26-14-23(15-27(20(3)4)31(26)33)13-24-16-28(21(5)6)32(29(17-24)22(7)8)34-18-25-11-9-10-12-30(25)35/h9-12,14-22,35H,13,33H2,1-8H3/b34-18+ |
| InChIKey | GUFZWOBBWGZFLB-FABQOPTDSA-N |
| XLogP | 8.81 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|