C29H38N2O — CID 59364866
2-[1-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylanilino]ethyl]phenol (PubChem CID 59364866) has the molecular formula C29H38N2O and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-[1-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylanilino]ethyl]phenol.
| Compound Name | 2-[1-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylanilino]ethyl]phenol |
|---|---|
| PubChem CID | 59364866 |
| Molecular Formula | C29H38N2O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 2-[1-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylanilino]ethyl]phenol |
| SMILES | Cc1cc(Cc2cc(C)c(NC(C)c3ccccc3O)c(C(C)C)c2)cc(C(C)C)c1N |
| InChI | InChI=1S/C29H38N2O/c1-17(2)25-15-22(12-19(5)28(25)30)14-23-13-20(6)29(26(16-23)18(3)4)31-21(7)24-10-8-9-11-27(24)32/h8-13,15-18,21,31-32H,14,30H2,1-7H3 |
| InChIKey | BPZGWIWVGVGCRG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|