C29H36N2O2 — CID 135997127
4-[N-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylphenyl]-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 135997127) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-[N-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylphenyl]-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylphenyl]-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135997127 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 4-[N-[4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylphenyl]-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | C/C(=N\c1c(C)cc(Cc2cc(C)c(N)c(C(C)C)c2)cc1C(C)C)c1ccc(O)cc1O |
| InChI | InChI=1S/C29H36N2O2/c1-16(2)25-13-21(10-18(5)28(25)30)12-22-11-19(6)29(26(14-22)17(3)4)31-20(7)24-9-8-23(32)15-27(24)33/h8-11,13-17,32-33H,12,30H2,1-7H3/b31-20+ |
| InChIKey | VMESWMPNZMJRIV-AJBULDERSA-N |
| XLogP | 7.28 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|