C32H44N2O — CID 59364880
3-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)anilino]methyl]phenol (PubChem CID 59364880) has the molecular formula C32H44N2O and a molecular weight of 472.72 g/mol. Its IUPAC name is 3-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)anilino]methyl]phenol.
| Compound Name | 3-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 59364880 |
| Molecular Formula | C32H44N2O |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.35 |
| IUPAC Name | 3-[[4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)anilino]methyl]phenol |
| SMILES | CC(C)c1cc(Cc2cc(C(C)C)c(NCc3cccc(O)c3)c(C(C)C)c2)cc(C(C)C)c1N |
| InChI | InChI=1S/C32H44N2O/c1-19(2)27-14-24(15-28(20(3)4)31(27)33)12-25-16-29(21(5)6)32(30(17-25)22(7)8)34-18-23-10-9-11-26(35)13-23/h9-11,13-17,19-22,34-35H,12,18,33H2,1-8H3 |
| InChIKey | ZPQJRSKWXWGLDJ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|