C24H28N2O — CID 59364819
4-[[4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylanilino]methyl]phenol (PubChem CID 59364819) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[[4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylanilino]methyl]phenol.
| Compound Name | 4-[[4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylanilino]methyl]phenol |
|---|---|
| PubChem CID | 59364819 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-[[4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylanilino]methyl]phenol |
| SMILES | Cc1cc(Cc2cc(C)c(NCc3ccc(O)cc3)c(C)c2)cc(C)c1N |
| InChI | InChI=1S/C24H28N2O/c1-15-9-20(10-16(2)23(15)25)13-21-11-17(3)24(18(4)12-21)26-14-19-5-7-22(27)8-6-19/h5-12,26-27H,13-14,25H2,1-4H3 |
| InChIKey | KKKHJQJYSMMAQW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|