About 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol
2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol (PubChem CID 71049445) has the molecular formula C28H30N2O
and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol.
Molecular Properties
| Compound Name | 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol |
| PubChem CID | 71049445 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol |
| SMILES | Cc1cc(C)c(NCc2ccc3ccccc3c2N[C@@H](C)c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C28H30N2O/c1-18-15-19(2)27(20(3)16-18)29-17-23-14-13-22-9-5-6-11-25(22)28(23)30-21(4)24-10-7-8-12-26(24)31/h5-16,21,29-31H,17H2,1-4H3/t21-/m0/s1 |
| InChIKey | PCDGJTOWZMHAOQ-NRFANRHFSA-N |
| XLogP | 7.26 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol?
The IUPAC name of 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol (CID 71049445) is 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol.
What is the SMILES notation for 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol?
The canonical SMILES for 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol is Cc1cc(C)c(NCc2ccc3ccccc3c2N[C@@H](C)c2ccccc2O)c(C)c1.
What is the InChIKey of 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol?
The InChIKey is PCDGJTOWZMHAOQ-NRFANRHFSA-N. The full InChI is InChI=1S/C28H30N2O/c1-18-15-19(2)27(20(3)16-18)29-17-23-14-13-22-9-5-6-11-25(22)28(23)30-21(4)24-10-7-8-12-26(24)31/h5-16,21,29-31H,17H2,1-4H3/t21-/m0/s1.
What are the key properties of 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol?
2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol has a molecular weight of 410.56 g/mol, XLogP of 7.26, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol is sourced from PubChem (CID 71049445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).