C28H30N2O — CID 71049445
2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol (PubChem CID 71049445) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol.
| Compound Name | 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 71049445 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-[(1S)-1-[[2-[(2,4,6-trimethylanilino)methyl]naphthalen-1-yl]amino]ethyl]phenol |
| SMILES | Cc1cc(C)c(NCc2ccc3ccccc3c2N[C@@H](C)c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C28H30N2O/c1-18-15-19(2)27(20(3)16-18)29-17-23-14-13-22-9-5-6-11-25(22)28(23)30-21(4)24-10-7-8-12-26(24)31/h5-16,21,29-31H,17H2,1-4H3/t21-/m0/s1 |
| InChIKey | PCDGJTOWZMHAOQ-NRFANRHFSA-N |
| XLogP | 7.26 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|