About 2-bromo-3,5-di(propan-2-yl)phenol
2-bromo-3,5-di(propan-2-yl)phenol (PubChem CID 11550631) has the molecular formula C12H17BrO
and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-bromo-3,5-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-bromo-3,5-di(propan-2-yl)phenol |
| PubChem CID | 11550631 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-bromo-3,5-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(O)c(Br)c(C(C)C)c1 |
| InChI | InChI=1S/C12H17BrO/c1-7(2)9-5-10(8(3)4)12(13)11(14)6-9/h5-8,14H,1-4H3 |
| InChIKey | RGXBPCULDPIZEY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-3,5-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,5-di(propan-2-yl)phenol?
The IUPAC name of 2-bromo-3,5-di(propan-2-yl)phenol (CID 11550631) is 2-bromo-3,5-di(propan-2-yl)phenol.
What is the SMILES notation for 2-bromo-3,5-di(propan-2-yl)phenol?
The canonical SMILES for 2-bromo-3,5-di(propan-2-yl)phenol is CC(C)c1cc(O)c(Br)c(C(C)C)c1.
What is the InChIKey of 2-bromo-3,5-di(propan-2-yl)phenol?
The InChIKey is RGXBPCULDPIZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO/c1-7(2)9-5-10(8(3)4)12(13)11(14)6-9/h5-8,14H,1-4H3.
What are the key properties of 2-bromo-3,5-di(propan-2-yl)phenol?
2-bromo-3,5-di(propan-2-yl)phenol has a molecular weight of 257.17 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,5-di(propan-2-yl)phenol is sourced from PubChem (CID 11550631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).