C27H31BBr2 — CID 101493330
bis(4-bromophenyl)-[2,4,6-tri(propan-2-yl)phenyl]borane (PubChem CID 101493330) has the molecular formula C27H31BBr2 and a molecular weight of 526.17 g/mol. Its IUPAC name is bis(4-bromophenyl)-[2,4,6-tri(propan-2-yl)phenyl]borane.
| Compound Name | bis(4-bromophenyl)-[2,4,6-tri(propan-2-yl)phenyl]borane |
|---|---|
| PubChem CID | 101493330 |
| Molecular Formula | C27H31BBr2 |
| Molecular Weight | 526.17 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | bis(4-bromophenyl)-[2,4,6-tri(propan-2-yl)phenyl]borane |
| SMILES | CC(C)c1cc(C(C)C)c(B(c2ccc(Br)cc2)c2ccc(Br)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C27H31BBr2/c1-17(2)20-15-25(18(3)4)27(26(16-20)19(5)6)28(21-7-11-23(29)12-8-21)22-9-13-24(30)14-10-22/h7-19H,1-6H3 |
| InChIKey | JHJXCGRMMJGKPC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.17 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|