C15H18N2 — CID 139402598
4-tert-butyl-6-propan-2-ylbenzene-1,3-dicarbonitrile (PubChem CID 139402598) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-tert-butyl-6-propan-2-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-tert-butyl-6-propan-2-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139402598 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-tert-butyl-6-propan-2-ylbenzene-1,3-dicarbonitrile |
| SMILES | CC(C)c1cc(C(C)(C)C)c(C#N)cc1C#N |
| InChI | InChI=1S/C15H18N2/c1-10(2)13-7-14(15(3,4)5)12(9-17)6-11(13)8-16/h6-7,10H,1-5H3 |
| InChIKey | YJDJKJXIXABZLZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |