C12H13F2N — CID 158090877
5-(1,1-difluoroethyl)-2-propan-2-ylbenzonitrile (PubChem CID 158090877) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-propan-2-ylbenzonitrile.
| Compound Name | 5-(1,1-difluoroethyl)-2-propan-2-ylbenzonitrile |
|---|---|
| PubChem CID | 158090877 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-propan-2-ylbenzonitrile |
| SMILES | CC(C)c1ccc(C(C)(F)F)cc1C#N |
| InChI | InChI=1S/C12H13F2N/c1-8(2)11-5-4-10(12(3,13)14)6-9(11)7-15/h4-6,8H,1-3H3 |
| InChIKey | QZRZVTPKASONGS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |