C15H19N3 — CID 10377050
2,6-ditert-butylpyridine-3,5-dicarbonitrile (PubChem CID 10377050) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2,6-ditert-butylpyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-ditert-butylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 10377050 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2,6-ditert-butylpyridine-3,5-dicarbonitrile |
| SMILES | CC(C)(C)c1nc(C(C)(C)C)c(C#N)cc1C#N |
| InChI | InChI=1S/C15H19N3/c1-14(2,3)12-10(8-16)7-11(9-17)13(18-12)15(4,5)6/h7H,1-6H3 |
| InChIKey | FXVPUDOMNQNCMW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |