About 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile
6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile (PubChem CID 121251915) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile |
| PubChem CID | 121251915 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C#N)c(C)c1 |
| InChI | InChI=1S/C19H22N2O/c1-12-9-13(2)17(14(3)10-12)22-18-15(11-20)7-8-16(21-18)19(4,5)6/h7-10H,1-6H3 |
| InChIKey | YXNBKXHJZCNNBR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile?
The IUPAC name of 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile (CID 121251915) is 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile.
What is the SMILES notation for 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile?
The canonical SMILES for 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile is Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C#N)c(C)c1.
What is the InChIKey of 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile?
The InChIKey is YXNBKXHJZCNNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-12-9-13(2)17(14(3)10-12)22-18-15(11-20)7-8-16(21-18)19(4,5)6/h7-10H,1-6H3.
What are the key properties of 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile?
6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile has a molecular weight of 294.40 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonitrile is sourced from PubChem (CID 121251915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).