C14H13ClN2O3 — CID 176830724
6-chloro-3-nitro-2-(2,4,6-trimethylphenoxy)pyridine (PubChem CID 176830724) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 6-chloro-3-nitro-2-(2,4,6-trimethylphenoxy)pyridine.
| Compound Name | 6-chloro-3-nitro-2-(2,4,6-trimethylphenoxy)pyridine |
|---|---|
| PubChem CID | 176830724 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 6-chloro-3-nitro-2-(2,4,6-trimethylphenoxy)pyridine |
| SMILES | Cc1cc(C)c(Oc2nc(Cl)ccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-8-6-9(2)13(10(3)7-8)20-14-11(17(18)19)4-5-12(15)16-14/h4-7H,1-3H3 |
| InChIKey | UVGPQWQXCBXJCB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|