C14H15N3O3 — CID 80874556
5-nitro-6-(2,3,6-trimethylphenoxy)pyridin-2-amine (PubChem CID 80874556) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 5-nitro-6-(2,3,6-trimethylphenoxy)pyridin-2-amine.
| Compound Name | 5-nitro-6-(2,3,6-trimethylphenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 80874556 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5-nitro-6-(2,3,6-trimethylphenoxy)pyridin-2-amine |
| SMILES | Cc1ccc(C)c(Oc2nc(N)ccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H15N3O3/c1-8-4-5-9(2)13(10(8)3)20-14-11(17(18)19)6-7-12(15)16-14/h4-7H,1-3H3,(H2,15,16) |
| InChIKey | PYGJRWBDKLCULL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|