C11H7F2N3O3 — CID 80880828
6-(2,3-difluorophenoxy)-5-nitropyridin-2-amine (PubChem CID 80880828) has the molecular formula C11H7F2N3O3 and a molecular weight of 267.19 g/mol. Its IUPAC name is 6-(2,3-difluorophenoxy)-5-nitropyridin-2-amine.
| Compound Name | 6-(2,3-difluorophenoxy)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80880828 |
| Molecular Formula | C11H7F2N3O3 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 6-(2,3-difluorophenoxy)-5-nitropyridin-2-amine |
| SMILES | Nc1ccc([N+](=O)[O-])c(Oc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C11H7F2N3O3/c12-6-2-1-3-8(10(6)13)19-11-7(16(17)18)4-5-9(14)15-11/h1-5H,(H2,14,15) |
| InChIKey | PKYMPXOORKPBSB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|