C13H11ClN2O5 — CID 61038338
6-chloro-2-(3,5-dimethoxyphenoxy)-3-nitropyridine (PubChem CID 61038338) has the molecular formula C13H11ClN2O5 and a molecular weight of 310.69 g/mol. Its IUPAC name is 6-chloro-2-(3,5-dimethoxyphenoxy)-3-nitropyridine.
| Compound Name | 6-chloro-2-(3,5-dimethoxyphenoxy)-3-nitropyridine |
|---|---|
| PubChem CID | 61038338 |
| Molecular Formula | C13H11ClN2O5 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 6-chloro-2-(3,5-dimethoxyphenoxy)-3-nitropyridine |
| SMILES | COc1cc(OC)cc(Oc2nc(Cl)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11ClN2O5/c1-19-8-5-9(20-2)7-10(6-8)21-13-11(16(17)18)3-4-12(14)15-13/h3-7H,1-2H3 |
| InChIKey | NIFYTVXGNPARMO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|