C14H14ClN3O2 — CID 62004028
6-chloro-N-(3,5-dimethylphenyl)-N-methyl-3-nitropyridin-2-amine (PubChem CID 62004028) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 6-chloro-N-(3,5-dimethylphenyl)-N-methyl-3-nitropyridin-2-amine.
| Compound Name | 6-chloro-N-(3,5-dimethylphenyl)-N-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 62004028 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6-chloro-N-(3,5-dimethylphenyl)-N-methyl-3-nitropyridin-2-amine |
| SMILES | Cc1cc(C)cc(N(C)c2nc(Cl)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-9-6-10(2)8-11(7-9)17(3)14-12(18(19)20)4-5-13(15)16-14/h4-8H,1-3H3 |
| InChIKey | OGPBJCMQUKPKBX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|